C21H27FN6S — CID 7389586
1-(2-fluorophenyl)-4-[(1S)-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]pentyl]piperazine (PubChem CID 7389586) has the molecular formula C21H27FN6S and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4-[(1S)-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]pentyl]piperazine.
| Compound Name | 1-(2-fluorophenyl)-4-[(1S)-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]pentyl]piperazine |
|---|---|
| PubChem CID | 7389586 |
| Molecular Formula | C21H27FN6S |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 1-(2-fluorophenyl)-4-[(1S)-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]pentyl]piperazine |
| SMILES | CCCC[C@@H](c1nnnn1Cc1cccs1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C21H27FN6S/c1-2-3-9-20(21-23-24-25-28(21)16-17-7-6-15-29-17)27-13-11-26(12-14-27)19-10-5-4-8-18(19)22/h4-8,10,15,20H,2-3,9,11-14,16H2,1H3/t20-/m0/s1 |
| InChIKey | HOGWDYYGLABXGL-FQEVSTJZSA-N |
| XLogP | 3.98 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |