C16H26N6S — CID 1447705
1-ethyl-4-[(1R)-2-methyl-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]propyl]piperazine (PubChem CID 1447705) has the molecular formula C16H26N6S and a molecular weight of 334.49 g/mol. Its IUPAC name is 1-ethyl-4-[(1R)-2-methyl-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]propyl]piperazine.
| Compound Name | 1-ethyl-4-[(1R)-2-methyl-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]propyl]piperazine |
|---|---|
| PubChem CID | 1447705 |
| Molecular Formula | C16H26N6S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1-ethyl-4-[(1R)-2-methyl-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]propyl]piperazine |
| SMILES | CCN1CCN([C@@H](c2nnnn2Cc2cccs2)C(C)C)CC1 |
| InChI | InChI=1S/C16H26N6S/c1-4-20-7-9-21(10-8-20)15(13(2)3)16-17-18-19-22(16)12-14-6-5-11-23-14/h5-6,11,13,15H,4,7-10,12H2,1-3H3/t15-/m1/s1 |
| InChIKey | AZWDALDCAAZGOD-OAHLLOKOSA-N |
| XLogP | 2.12 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |