C19H24N6S — CID 51685867
1-[(R)-(1-benzyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-ethylpiperazine (PubChem CID 51685867) has the molecular formula C19H24N6S and a molecular weight of 368.51 g/mol. Its IUPAC name is 1-[(R)-(1-benzyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-ethylpiperazine.
| Compound Name | 1-[(R)-(1-benzyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-ethylpiperazine |
|---|---|
| PubChem CID | 51685867 |
| Molecular Formula | C19H24N6S |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-[(R)-(1-benzyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-ethylpiperazine |
| SMILES | CCN1CCN([C@@H](c2cccs2)c2nnnn2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H24N6S/c1-2-23-10-12-24(13-11-23)18(17-9-6-14-26-17)19-20-21-22-25(19)15-16-7-4-3-5-8-16/h3-9,14,18H,2,10-13,15H2,1H3/t18-/m0/s1 |
| InChIKey | QIXQMLPVGOAVKY-SFHVURJKSA-N |
| XLogP | 2.51 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |