C17H27ClN6 — CID 171668375
1-[1-(1-benzyltetrazol-5-yl)propyl]-4-ethylpiperazine;hydrochloride (PubChem CID 171668375) has the molecular formula C17H27ClN6 and a molecular weight of 350.90 g/mol. Its IUPAC name is 1-[1-(1-benzyltetrazol-5-yl)propyl]-4-ethylpiperazine;hydrochloride.
| Compound Name | 1-[1-(1-benzyltetrazol-5-yl)propyl]-4-ethylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 171668375 |
| Molecular Formula | C17H27ClN6 |
| Molecular Weight | 350.90 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-[1-(1-benzyltetrazol-5-yl)propyl]-4-ethylpiperazine;hydrochloride |
| SMILES | CCC(c1nnnn1Cc1ccccc1)N1CCN(CC)CC1.Cl |
| InChI | InChI=1S/C17H26N6.ClH/c1-3-16(22-12-10-21(4-2)11-13-22)17-18-19-20-23(17)14-15-8-6-5-7-9-15;/h5-9,16H,3-4,10-14H2,1-2H3;1H |
| InChIKey | WYKKDNKEXHIORQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.90 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |