C19H31ClN6 — CID 171668184
1-benzyl-4-[1-(1-tert-butyltetrazol-5-yl)propyl]piperazine;hydrochloride (PubChem CID 171668184) has the molecular formula C19H31ClN6 and a molecular weight of 378.95 g/mol. Its IUPAC name is 1-benzyl-4-[1-(1-tert-butyltetrazol-5-yl)propyl]piperazine;hydrochloride.
| Compound Name | 1-benzyl-4-[1-(1-tert-butyltetrazol-5-yl)propyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171668184 |
| Molecular Formula | C19H31ClN6 |
| Molecular Weight | 378.95 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 1-benzyl-4-[1-(1-tert-butyltetrazol-5-yl)propyl]piperazine;hydrochloride |
| SMILES | CCC(c1nnnn1C(C)(C)C)N1CCN(Cc2ccccc2)CC1.Cl |
| InChI | InChI=1S/C19H30N6.ClH/c1-5-17(18-20-21-22-25(18)19(2,3)4)24-13-11-23(12-14-24)15-16-9-7-6-8-10-16;/h6-10,17H,5,11-15H2,1-4H3;1H |
| InChIKey | DEERQMDFFYURQY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.95 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |