C22H36N6 — CID 1444378
1-benzyl-4-[(1S)-3-methyl-1-[1-(2-methylbutan-2-yl)tetrazol-5-yl]butyl]piperazine (PubChem CID 1444378) has the molecular formula C22H36N6 and a molecular weight of 384.57 g/mol. Its IUPAC name is 1-benzyl-4-[(1S)-3-methyl-1-[1-(2-methylbutan-2-yl)tetrazol-5-yl]butyl]piperazine.
| Compound Name | 1-benzyl-4-[(1S)-3-methyl-1-[1-(2-methylbutan-2-yl)tetrazol-5-yl]butyl]piperazine |
|---|---|
| PubChem CID | 1444378 |
| Molecular Formula | C22H36N6 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 1-benzyl-4-[(1S)-3-methyl-1-[1-(2-methylbutan-2-yl)tetrazol-5-yl]butyl]piperazine |
| SMILES | CCC(C)(C)n1nnnc1[C@H](CC(C)C)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H36N6/c1-6-22(4,5)28-21(23-24-25-28)20(16-18(2)3)27-14-12-26(13-15-27)17-19-10-8-7-9-11-19/h7-11,18,20H,6,12-17H2,1-5H3/t20-/m0/s1 |
| InChIKey | NRSLVRREVYWBEH-FQEVSTJZSA-N |
| XLogP | 3.72 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |