C18H21N5OS2 — CID 1432179
4-[(S)-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-thiophen-2-ylmethyl]thiomorpholine (PubChem CID 1432179) has the molecular formula C18H21N5OS2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 4-[(S)-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-thiophen-2-ylmethyl]thiomorpholine.
| Compound Name | 4-[(S)-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-thiophen-2-ylmethyl]thiomorpholine |
|---|---|
| PubChem CID | 1432179 |
| Molecular Formula | C18H21N5OS2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 4-[(S)-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-thiophen-2-ylmethyl]thiomorpholine |
| SMILES | COc1ccc(Cn2nnnc2[C@@H](c2cccs2)N2CCSCC2)cc1 |
| InChI | InChI=1S/C18H21N5OS2/c1-24-15-6-4-14(5-7-15)13-23-18(19-20-21-23)17(16-3-2-10-26-16)22-8-11-25-12-9-22/h2-7,10,17H,8-9,11-13H2,1H3/t17-/m1/s1 |
| InChIKey | BYEJNSKTZJXOCU-QGZVFWFLSA-N |
| XLogP | 2.93 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |