C24H23F3N6S — CID 3193439
1-[(1-benzyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 3193439) has the molecular formula C24H23F3N6S and a molecular weight of 484.55 g/mol. Its IUPAC name is 1-[(1-benzyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-[(1-benzyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 3193439 |
| Molecular Formula | C24H23F3N6S |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 1-[(1-benzyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | FC(F)(F)c1cccc(N2CCN(C(c3cccs3)c3nnnn3Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C24H23F3N6S/c25-24(26,27)19-8-4-9-20(16-19)31-11-13-32(14-12-31)22(21-10-5-15-34-21)23-28-29-30-33(23)17-18-6-2-1-3-7-18/h1-10,15-16,22H,11-14,17H2 |
| InChIKey | BVEQIUCNRCYVQD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |