C24H26N6OS — CID 1454781
4-[4-[(S)-[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperazin-1-yl]phenol (PubChem CID 1454781) has the molecular formula C24H26N6OS and a molecular weight of 446.58 g/mol. Its IUPAC name is 4-[4-[(S)-[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperazin-1-yl]phenol.
| Compound Name | 4-[4-[(S)-[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 1454781 |
| Molecular Formula | C24H26N6OS |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 4-[4-[(S)-[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperazin-1-yl]phenol |
| SMILES | Oc1ccc(N2CCN([C@H](c3cccs3)c3nnnn3CCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H26N6OS/c31-21-10-8-20(9-11-21)28-14-16-29(17-15-28)23(22-7-4-18-32-22)24-25-26-27-30(24)13-12-19-5-2-1-3-6-19/h1-11,18,23,31H,12-17H2/t23-/m1/s1 |
| InChIKey | BEDLASVQJVOIHR-HSZRJFAPSA-N |
| XLogP | 3.59 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |