C20H25N5S — CID 6557848
(3R)-3-methyl-1-[(R)-[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperidine (PubChem CID 6557848) has the molecular formula C20H25N5S and a molecular weight of 367.52 g/mol. Its IUPAC name is (3R)-3-methyl-1-[(R)-[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperidine.
| Compound Name | (3R)-3-methyl-1-[(R)-[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperidine |
|---|---|
| PubChem CID | 6557848 |
| Molecular Formula | C20H25N5S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (3R)-3-methyl-1-[(R)-[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperidine |
| SMILES | C[C@@H]1CCCN([C@@H](c2cccs2)c2nnnn2CCc2ccccc2)C1 |
| InChI | InChI=1S/C20H25N5S/c1-16-7-5-12-24(15-16)19(18-10-6-14-26-18)20-21-22-23-25(20)13-11-17-8-3-2-4-9-17/h2-4,6,8-10,14,16,19H,5,7,11-13,15H2,1H3/t16-,19+/m1/s1 |
| InChIKey | XTBUYGUTNMGODQ-APWZRJJASA-N |
| XLogP | 3.80 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |