C19H24N5OS+ — CID 7390809
1-[(R)-[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperidin-1-ium-4-ol (PubChem CID 7390809) has the molecular formula C19H24N5OS+ and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-[(R)-[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperidin-1-ium-4-ol.
| Compound Name | 1-[(R)-[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7390809 |
| Molecular Formula | C19H24N5OS+ |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-[(R)-[1-(2-phenylethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]piperidin-1-ium-4-ol |
| SMILES | OC1CC[NH+]([C@@H](c2cccs2)c2nnnn2CCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H23N5OS/c25-16-9-11-23(12-10-16)18(17-7-4-14-26-17)19-20-21-22-24(19)13-8-15-5-2-1-3-6-15/h1-7,14,16,18,25H,8-13H2/p+1/t18-/m0/s1 |
| InChIKey | OLOKJFVXTZTHEK-SFHVURJKSA-O |
| XLogP | 1.11 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |