C24H27N6O+ — CID 7385373
1-[(R)-[1-(2-phenylethyl)tetrazol-5-yl]-quinolin-6-ylmethyl]piperidin-1-ium-4-ol (PubChem CID 7385373) has the molecular formula C24H27N6O+ and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-[(R)-[1-(2-phenylethyl)tetrazol-5-yl]-quinolin-6-ylmethyl]piperidin-1-ium-4-ol.
| Compound Name | 1-[(R)-[1-(2-phenylethyl)tetrazol-5-yl]-quinolin-6-ylmethyl]piperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7385373 |
| Molecular Formula | C24H27N6O+ |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 1-[(R)-[1-(2-phenylethyl)tetrazol-5-yl]-quinolin-6-ylmethyl]piperidin-1-ium-4-ol |
| SMILES | OC1CC[NH+](C(c2ccc3ncccc3c2)c2nnnn2CCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H26N6O/c31-21-11-14-29(15-12-21)23(20-8-9-22-19(17-20)7-4-13-25-22)24-26-27-28-30(24)16-10-18-5-2-1-3-6-18/h1-9,13,17,21,23,31H,10-12,14-16H2/p+1 |
| InChIKey | INNHOOLWWLKXHE-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |