C17H26N5S+ — CID 7390833
4-[(1R)-2-methyl-1-[1-(2-phenylethyl)tetrazol-5-yl]propyl]thiomorpholin-4-ium (PubChem CID 7390833) has the molecular formula C17H26N5S+ and a molecular weight of 332.50 g/mol. Its IUPAC name is 4-[(1R)-2-methyl-1-[1-(2-phenylethyl)tetrazol-5-yl]propyl]thiomorpholin-4-ium.
| Compound Name | 4-[(1R)-2-methyl-1-[1-(2-phenylethyl)tetrazol-5-yl]propyl]thiomorpholin-4-ium |
|---|---|
| PubChem CID | 7390833 |
| Molecular Formula | C17H26N5S+ |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 4-[(1R)-2-methyl-1-[1-(2-phenylethyl)tetrazol-5-yl]propyl]thiomorpholin-4-ium |
| SMILES | CC(C)[C@H](c1nnnn1CCc1ccccc1)[NH+]1CCSCC1 |
| InChI | InChI=1S/C17H25N5S/c1-14(2)16(21-10-12-23-13-11-21)17-18-19-20-22(17)9-8-15-6-4-3-5-7-15/h3-7,14,16H,8-13H2,1-2H3/p+1/t16-/m1/s1 |
| InChIKey | CZLUQTSJTVQBRX-MRXNPFEDSA-O |
| XLogP | 1.24 |
| TPSA | 48.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |