C13H19N5 — CID 103085404
N-ethyl-1-[1-(2-phenylethyl)tetrazol-5-yl]ethanamine (PubChem CID 103085404) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is N-ethyl-1-[1-(2-phenylethyl)tetrazol-5-yl]ethanamine.
| Compound Name | N-ethyl-1-[1-(2-phenylethyl)tetrazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 103085404 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | N-ethyl-1-[1-(2-phenylethyl)tetrazol-5-yl]ethanamine |
| SMILES | CCNC(C)c1nnnn1CCc1ccccc1 |
| InChI | InChI=1S/C13H19N5/c1-3-14-11(2)13-15-16-17-18(13)10-9-12-7-5-4-6-8-12/h4-8,11,14H,3,9-10H2,1-2H3 |
| InChIKey | IUYSOFKGSCMNMQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |