C18H27N5 — CID 3213474
1-[2-methyl-1-[1-(2-phenylethyl)tetrazol-5-yl]propyl]piperidine (PubChem CID 3213474) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is 1-[2-methyl-1-[1-(2-phenylethyl)tetrazol-5-yl]propyl]piperidine.
| Compound Name | 1-[2-methyl-1-[1-(2-phenylethyl)tetrazol-5-yl]propyl]piperidine |
|---|---|
| PubChem CID | 3213474 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 1-[2-methyl-1-[1-(2-phenylethyl)tetrazol-5-yl]propyl]piperidine |
| SMILES | CC(C)C(c1nnnn1CCc1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C18H27N5/c1-15(2)17(22-12-7-4-8-13-22)18-19-20-21-23(18)14-11-16-9-5-3-6-10-16/h3,5-6,9-10,15,17H,4,7-8,11-14H2,1-2H3 |
| InChIKey | LKUFFRHDRKWEEH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |