C21H25ClN6 — CID 1449183
1-[(R)-(2-chlorophenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine (PubChem CID 1449183) has the molecular formula C21H25ClN6 and a molecular weight of 396.93 g/mol. Its IUPAC name is 1-[(R)-(2-chlorophenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine.
| Compound Name | 1-[(R)-(2-chlorophenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 1449183 |
| Molecular Formula | C21H25ClN6 |
| Molecular Weight | 396.93 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-[(R)-(2-chlorophenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine |
| SMILES | CN1CCN([C@H](c2ccccc2Cl)c2nnnn2CCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H25ClN6/c1-26-13-15-27(16-14-26)20(18-9-5-6-10-19(18)22)21-23-24-25-28(21)12-11-17-7-3-2-4-8-17/h2-10,20H,11-16H2,1H3/t20-/m1/s1 |
| InChIKey | LGYPWORODCTCEQ-HXUWFJFHSA-N |
| XLogP | 2.91 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.93 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |