C23H30N6O — CID 7397427
1-ethyl-4-[(R)-(2-methoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]piperazine (PubChem CID 7397427) has the molecular formula C23H30N6O and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-ethyl-4-[(R)-(2-methoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]piperazine.
| Compound Name | 1-ethyl-4-[(R)-(2-methoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]piperazine |
|---|---|
| PubChem CID | 7397427 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 1-ethyl-4-[(R)-(2-methoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]piperazine |
| SMILES | CCN1CCN([C@H](c2ccccc2OC)c2nnnn2CCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N6O/c1-3-27-15-17-28(18-16-27)22(20-11-7-8-12-21(20)30-2)23-24-25-26-29(23)14-13-19-9-5-4-6-10-19/h4-12,22H,3,13-18H2,1-2H3/t22-/m1/s1 |
| InChIKey | JZXOXDLLFLRREW-JOCHJYFZSA-N |
| XLogP | 2.65 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |