C18H28N6O2 — CID 7391642
1-ethyl-4-[(R)-[1-(2-methoxyethyl)tetrazol-5-yl]-(2-methoxyphenyl)methyl]piperazine (PubChem CID 7391642) has the molecular formula C18H28N6O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-ethyl-4-[(R)-[1-(2-methoxyethyl)tetrazol-5-yl]-(2-methoxyphenyl)methyl]piperazine.
| Compound Name | 1-ethyl-4-[(R)-[1-(2-methoxyethyl)tetrazol-5-yl]-(2-methoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 7391642 |
| Molecular Formula | C18H28N6O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 1-ethyl-4-[(R)-[1-(2-methoxyethyl)tetrazol-5-yl]-(2-methoxyphenyl)methyl]piperazine |
| SMILES | CCN1CCN([C@H](c2ccccc2OC)c2nnnn2CCOC)CC1 |
| InChI | InChI=1S/C18H28N6O2/c1-4-22-9-11-23(12-10-22)17(15-7-5-6-8-16(15)26-3)18-19-20-21-24(18)13-14-25-2/h5-8,17H,4,9-14H2,1-3H3/t17-/m1/s1 |
| InChIKey | WMLPEATVXVZCKO-QGZVFWFLSA-N |
| XLogP | 1.05 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |