C24H32N5+ — CID 7140417
4-benzyl-1-[(1S)-1-(1-benzyltetrazol-5-yl)-2-methylpropyl]piperidin-1-ium (PubChem CID 7140417) has the molecular formula C24H32N5+ and a molecular weight of 390.56 g/mol. Its IUPAC name is 4-benzyl-1-[(1S)-1-(1-benzyltetrazol-5-yl)-2-methylpropyl]piperidin-1-ium.
| Compound Name | 4-benzyl-1-[(1S)-1-(1-benzyltetrazol-5-yl)-2-methylpropyl]piperidin-1-ium |
|---|---|
| PubChem CID | 7140417 |
| Molecular Formula | C24H32N5+ |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 4-benzyl-1-[(1S)-1-(1-benzyltetrazol-5-yl)-2-methylpropyl]piperidin-1-ium |
| SMILES | CC(C)[C@@H](c1nnnn1Cc1ccccc1)[NH+]1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H31N5/c1-19(2)23(24-25-26-27-29(24)18-22-11-7-4-8-12-22)28-15-13-21(14-16-28)17-20-9-5-3-6-10-20/h3-12,19,21,23H,13-18H2,1-2H3/p+1/t23-/m0/s1 |
| InChIKey | OADOJOVGDNHLFX-QHCPKHFHSA-O |
| XLogP | 2.96 |
| TPSA | 48.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |