C22H28N5O+ — CID 6985788
1-[(S)-(1-benzyltetrazol-5-yl)-(4-methoxyphenyl)methyl]-4-methylpiperidin-1-ium (PubChem CID 6985788) has the molecular formula C22H28N5O+ and a molecular weight of 378.50 g/mol. Its IUPAC name is 1-[(S)-(1-benzyltetrazol-5-yl)-(4-methoxyphenyl)methyl]-4-methylpiperidin-1-ium.
| Compound Name | 1-[(S)-(1-benzyltetrazol-5-yl)-(4-methoxyphenyl)methyl]-4-methylpiperidin-1-ium |
|---|---|
| PubChem CID | 6985788 |
| Molecular Formula | C22H28N5O+ |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 1-[(S)-(1-benzyltetrazol-5-yl)-(4-methoxyphenyl)methyl]-4-methylpiperidin-1-ium |
| SMILES | COc1ccc([C@@H](c2nnnn2Cc2ccccc2)[NH+]2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C22H27N5O/c1-17-12-14-26(15-13-17)21(19-8-10-20(28-2)11-9-19)22-23-24-25-27(22)16-18-6-4-3-5-7-18/h3-11,17,21H,12-16H2,1-2H3/p+1/t21-/m0/s1 |
| InChIKey | NZDYFOWLISAGRE-NRFANRHFSA-O |
| XLogP | 2.13 |
| TPSA | 57.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |