C21H24ClN6O+ — CID 7396384
1-[(S)-(1-benzyltetrazol-5-yl)-(4-chlorophenyl)methyl]piperidin-1-ium-4-carboxamide (PubChem CID 7396384) has the molecular formula C21H24ClN6O+ and a molecular weight of 411.92 g/mol. Its IUPAC name is 1-[(S)-(1-benzyltetrazol-5-yl)-(4-chlorophenyl)methyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(S)-(1-benzyltetrazol-5-yl)-(4-chlorophenyl)methyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7396384 |
| Molecular Formula | C21H24ClN6O+ |
| Molecular Weight | 411.92 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1-[(S)-(1-benzyltetrazol-5-yl)-(4-chlorophenyl)methyl]piperidin-1-ium-4-carboxamide |
| SMILES | NC(=O)C1CC[NH+]([C@@H](c2ccc(Cl)cc2)c2nnnn2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H23ClN6O/c22-18-8-6-16(7-9-18)19(27-12-10-17(11-13-27)20(23)29)21-24-25-26-28(21)14-15-4-2-1-3-5-15/h1-9,17,19H,10-14H2,(H2,23,29)/p+1/t19-/m0/s1 |
| InChIKey | HIFMNEOQGAHMNZ-IBGZPJMESA-O |
| XLogP | 1.24 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.92 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |