C18H27N6O+ — CID 7384068
1-[(S)-(1-tert-butyltetrazol-5-yl)-phenylmethyl]piperidin-1-ium-4-carboxamide (PubChem CID 7384068) has the molecular formula C18H27N6O+ and a molecular weight of 343.46 g/mol. Its IUPAC name is 1-[(S)-(1-tert-butyltetrazol-5-yl)-phenylmethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(S)-(1-tert-butyltetrazol-5-yl)-phenylmethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7384068 |
| Molecular Formula | C18H27N6O+ |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | 1-[(S)-(1-tert-butyltetrazol-5-yl)-phenylmethyl]piperidin-1-ium-4-carboxamide |
| SMILES | CC(C)(C)n1nnnc1[C@H](c1ccccc1)[NH+]1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C18H26N6O/c1-18(2,3)24-17(20-21-22-24)15(13-7-5-4-6-8-13)23-11-9-14(10-12-23)16(19)25/h4-8,14-15H,9-12H2,1-3H3,(H2,19,25)/p+1/t15-/m0/s1 |
| InChIKey | AZJAWZLJKKXDBT-HNNXBMFYSA-O |
| XLogP | 0.30 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |