C19H29N6O+ — CID 7391332
1-[(S)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]-phenylmethyl]piperidin-1-ium-4-carboxamide (PubChem CID 7391332) has the molecular formula C19H29N6O+ and a molecular weight of 357.48 g/mol. Its IUPAC name is 1-[(S)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]-phenylmethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(S)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]-phenylmethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7391332 |
| Molecular Formula | C19H29N6O+ |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 1-[(S)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]-phenylmethyl]piperidin-1-ium-4-carboxamide |
| SMILES | CCC(C)(C)n1nnnc1[C@H](c1ccccc1)[NH+]1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C19H28N6O/c1-4-19(2,3)25-18(21-22-23-25)16(14-8-6-5-7-9-14)24-12-10-15(11-13-24)17(20)26/h5-9,15-16H,4,10-13H2,1-3H3,(H2,20,26)/p+1/t16-/m0/s1 |
| InChIKey | JNNVKHUJSOXLLC-INIZCTEOSA-O |
| XLogP | 0.69 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |