C18H27ClN5+ — CID 7382923
1-[(R)-(1-tert-butyltetrazol-5-yl)-(4-chlorophenyl)methyl]-4-methylpiperidin-1-ium (PubChem CID 7382923) has the molecular formula C18H27ClN5+ and a molecular weight of 348.90 g/mol. Its IUPAC name is 1-[(R)-(1-tert-butyltetrazol-5-yl)-(4-chlorophenyl)methyl]-4-methylpiperidin-1-ium.
| Compound Name | 1-[(R)-(1-tert-butyltetrazol-5-yl)-(4-chlorophenyl)methyl]-4-methylpiperidin-1-ium |
|---|---|
| PubChem CID | 7382923 |
| Molecular Formula | C18H27ClN5+ |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 1-[(R)-(1-tert-butyltetrazol-5-yl)-(4-chlorophenyl)methyl]-4-methylpiperidin-1-ium |
| SMILES | CC1CC[NH+]([C@H](c2ccc(Cl)cc2)c2nnnn2C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H26ClN5/c1-13-9-11-23(12-10-13)16(14-5-7-15(19)8-6-14)17-20-21-22-24(17)18(2,3)4/h5-8,13,16H,9-12H2,1-4H3/p+1/t16-/m1/s1 |
| InChIKey | QDZISVBHZUKWJV-MRXNPFEDSA-O |
| XLogP | 2.49 |
| TPSA | 48.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |