C19H28N5+ — CID 7382841
1-[(R)-(1-cyclopentyltetrazol-5-yl)-phenylmethyl]-4-methylpiperidin-1-ium (PubChem CID 7382841) has the molecular formula C19H28N5+ and a molecular weight of 326.47 g/mol. Its IUPAC name is 1-[(R)-(1-cyclopentyltetrazol-5-yl)-phenylmethyl]-4-methylpiperidin-1-ium.
| Compound Name | 1-[(R)-(1-cyclopentyltetrazol-5-yl)-phenylmethyl]-4-methylpiperidin-1-ium |
|---|---|
| PubChem CID | 7382841 |
| Molecular Formula | C19H28N5+ |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | 1-[(R)-(1-cyclopentyltetrazol-5-yl)-phenylmethyl]-4-methylpiperidin-1-ium |
| SMILES | CC1CC[NH+]([C@H](c2ccccc2)c2nnnn2C2CCCC2)CC1 |
| InChI | InChI=1S/C19H27N5/c1-15-11-13-23(14-12-15)18(16-7-3-2-4-8-16)19-20-21-22-24(19)17-9-5-6-10-17/h2-4,7-8,15,17-18H,5-6,9-14H2,1H3/p+1/t18-/m1/s1 |
| InChIKey | LISIFAWKIDVTLT-GOSISDBHSA-O |
| XLogP | 2.19 |
| TPSA | 48.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |