C16H23N6O+ — CID 6985832
4-[(R)-(1-cyclopentyltetrazol-5-yl)-pyridin-4-ylmethyl]morpholin-4-ium (PubChem CID 6985832) has the molecular formula C16H23N6O+ and a molecular weight of 315.40 g/mol. Its IUPAC name is 4-[(R)-(1-cyclopentyltetrazol-5-yl)-pyridin-4-ylmethyl]morpholin-4-ium.
| Compound Name | 4-[(R)-(1-cyclopentyltetrazol-5-yl)-pyridin-4-ylmethyl]morpholin-4-ium |
|---|---|
| PubChem CID | 6985832 |
| Molecular Formula | C16H23N6O+ |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 4-[(R)-(1-cyclopentyltetrazol-5-yl)-pyridin-4-ylmethyl]morpholin-4-ium |
| SMILES | c1cc([C@H](c2nnnn2C2CCCC2)[NH+]2CCOCC2)ccn1 |
| InChI | InChI=1S/C16H22N6O/c1-2-4-14(3-1)22-16(18-19-20-22)15(13-5-7-17-8-6-13)21-9-11-23-12-10-21/h5-8,14-15H,1-4,9-12H2/p+1/t15-/m1/s1 |
| InChIKey | JEKVVIFIZUGAPB-OAHLLOKOSA-O |
| XLogP | 0.19 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |