C18H25FN5+ — CID 7125336
1-cyclohexyl-5-[(R)-(4-fluorophenyl)-pyrrolidin-1-ium-1-ylmethyl]tetrazole (PubChem CID 7125336) has the molecular formula C18H25FN5+ and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-cyclohexyl-5-[(R)-(4-fluorophenyl)-pyrrolidin-1-ium-1-ylmethyl]tetrazole.
| Compound Name | 1-cyclohexyl-5-[(R)-(4-fluorophenyl)-pyrrolidin-1-ium-1-ylmethyl]tetrazole |
|---|---|
| PubChem CID | 7125336 |
| Molecular Formula | C18H25FN5+ |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 1-cyclohexyl-5-[(R)-(4-fluorophenyl)-pyrrolidin-1-ium-1-ylmethyl]tetrazole |
| SMILES | Fc1ccc([C@H](c2nnnn2C2CCCCC2)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C18H24FN5/c19-15-10-8-14(9-11-15)17(23-12-4-5-13-23)18-20-21-22-24(18)16-6-2-1-3-7-16/h8-11,16-17H,1-7,12-13H2/p+1/t17-/m1/s1 |
| InChIKey | ZARJHHCDMYLLLQ-QGZVFWFLSA-O |
| XLogP | 2.09 |
| TPSA | 48.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |