C19H27FN5+ — CID 7242468
1-[(S)-(1-cyclohexyltetrazol-5-yl)-(4-fluorophenyl)methyl]piperidin-1-ium (PubChem CID 7242468) has the molecular formula C19H27FN5+ and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-[(S)-(1-cyclohexyltetrazol-5-yl)-(4-fluorophenyl)methyl]piperidin-1-ium.
| Compound Name | 1-[(S)-(1-cyclohexyltetrazol-5-yl)-(4-fluorophenyl)methyl]piperidin-1-ium |
|---|---|
| PubChem CID | 7242468 |
| Molecular Formula | C19H27FN5+ |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-[(S)-(1-cyclohexyltetrazol-5-yl)-(4-fluorophenyl)methyl]piperidin-1-ium |
| SMILES | Fc1ccc([C@@H](c2nnnn2C2CCCCC2)[NH+]2CCCCC2)cc1 |
| InChI | InChI=1S/C19H26FN5/c20-16-11-9-15(10-12-16)18(24-13-5-2-6-14-24)19-21-22-23-25(19)17-7-3-1-4-8-17/h9-12,17-18H,1-8,13-14H2/p+1/t18-/m0/s1 |
| InChIKey | RHEPNOCGMNCBJO-SFHVURJKSA-O |
| XLogP | 2.48 |
| TPSA | 48.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |