C18H25ClN5O+ — CID 7140869
4-[(R)-(4-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]morpholin-4-ium (PubChem CID 7140869) has the molecular formula C18H25ClN5O+ and a molecular weight of 362.89 g/mol. Its IUPAC name is 4-[(R)-(4-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]morpholin-4-ium.
| Compound Name | 4-[(R)-(4-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]morpholin-4-ium |
|---|---|
| PubChem CID | 7140869 |
| Molecular Formula | C18H25ClN5O+ |
| Molecular Weight | 362.89 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 4-[(R)-(4-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]morpholin-4-ium |
| SMILES | Clc1ccc([C@H](c2nnnn2C2CCCCC2)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C18H24ClN5O/c19-15-8-6-14(7-9-15)17(23-10-12-25-13-11-23)18-20-21-22-24(18)16-4-2-1-3-5-16/h6-9,16-17H,1-5,10-13H2/p+1/t17-/m1/s1 |
| InChIKey | FIWNQJLTYWZKKV-QGZVFWFLSA-O |
| XLogP | 1.84 |
| TPSA | 57.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.89 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |