C20H33N7+2 — CID 7383081
4-[(S)-(1-cyclopentyltetrazol-5-yl)-(4-methylpiperazine-1,4-diium-1-yl)methyl]-N,N-dimethylaniline (PubChem CID 7383081) has the molecular formula C20H33N7+2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 4-[(S)-(1-cyclopentyltetrazol-5-yl)-(4-methylpiperazine-1,4-diium-1-yl)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(S)-(1-cyclopentyltetrazol-5-yl)-(4-methylpiperazine-1,4-diium-1-yl)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 7383081 |
| Molecular Formula | C20H33N7+2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | 4-[(S)-(1-cyclopentyltetrazol-5-yl)-(4-methylpiperazine-1,4-diium-1-yl)methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc([C@@H](c2nnnn2C2CCCC2)[NH+]2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C20H31N7/c1-24(2)17-10-8-16(9-11-17)19(26-14-12-25(3)13-15-26)20-21-22-23-27(20)18-6-4-5-7-18/h8-11,18-19H,4-7,12-15H2,1-3H3/p+2/t19-/m0/s1 |
| InChIKey | RKFAEZZMXNQWEQ-IBGZPJMESA-P |
| XLogP | -0.64 |
| TPSA | 55.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|