C20H30N5+ — CID 7382838
1-[(S)-(1-cyclohexyltetrazol-5-yl)-phenylmethyl]-4-methylpiperidin-1-ium (PubChem CID 7382838) has the molecular formula C20H30N5+ and a molecular weight of 340.50 g/mol. Its IUPAC name is 1-[(S)-(1-cyclohexyltetrazol-5-yl)-phenylmethyl]-4-methylpiperidin-1-ium.
| Compound Name | 1-[(S)-(1-cyclohexyltetrazol-5-yl)-phenylmethyl]-4-methylpiperidin-1-ium |
|---|---|
| PubChem CID | 7382838 |
| Molecular Formula | C20H30N5+ |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 1-[(S)-(1-cyclohexyltetrazol-5-yl)-phenylmethyl]-4-methylpiperidin-1-ium |
| SMILES | CC1CC[NH+]([C@@H](c2ccccc2)c2nnnn2C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H29N5/c1-16-12-14-24(15-13-16)19(17-8-4-2-5-9-17)20-21-22-23-25(20)18-10-6-3-7-11-18/h2,4-5,8-9,16,18-19H,3,6-7,10-15H2,1H3/p+1/t19-/m0/s1 |
| InChIKey | XAUOJDZIRPRWKN-IBGZPJMESA-O |
| XLogP | 2.58 |
| TPSA | 48.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |