C15H22N5OS+ — CID 7140874
4-[(R)-(1-cyclopentyltetrazol-5-yl)-thiophen-2-ylmethyl]morpholin-4-ium (PubChem CID 7140874) has the molecular formula C15H22N5OS+ and a molecular weight of 320.44 g/mol. Its IUPAC name is 4-[(R)-(1-cyclopentyltetrazol-5-yl)-thiophen-2-ylmethyl]morpholin-4-ium.
| Compound Name | 4-[(R)-(1-cyclopentyltetrazol-5-yl)-thiophen-2-ylmethyl]morpholin-4-ium |
|---|---|
| PubChem CID | 7140874 |
| Molecular Formula | C15H22N5OS+ |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 4-[(R)-(1-cyclopentyltetrazol-5-yl)-thiophen-2-ylmethyl]morpholin-4-ium |
| SMILES | c1csc([C@@H](c2nnnn2C2CCCC2)[NH+]2CCOCC2)c1 |
| InChI | InChI=1S/C15H21N5OS/c1-2-5-12(4-1)20-15(16-17-18-20)14(13-6-3-11-22-13)19-7-9-21-10-8-19/h3,6,11-12,14H,1-2,4-5,7-10H2/p+1/t14-/m0/s1 |
| InChIKey | JZFZKZOWGMEMGC-AWEZNQCLSA-O |
| XLogP | 0.85 |
| TPSA | 57.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |