C22H34N5S+ — CID 7140523
2-[(R)-(1-cyclohexyltetrazol-5-yl)-thiophen-2-ylmethyl]-2-azoniaspiro[5.5]undecane (PubChem CID 7140523) has the molecular formula C22H34N5S+ and a molecular weight of 400.62 g/mol. Its IUPAC name is 2-[(R)-(1-cyclohexyltetrazol-5-yl)-thiophen-2-ylmethyl]-2-azoniaspiro[5.5]undecane.
| Compound Name | 2-[(R)-(1-cyclohexyltetrazol-5-yl)-thiophen-2-ylmethyl]-2-azoniaspiro[5.5]undecane |
|---|---|
| PubChem CID | 7140523 |
| Molecular Formula | C22H34N5S+ |
| Molecular Weight | 400.62 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 2-[(R)-(1-cyclohexyltetrazol-5-yl)-thiophen-2-ylmethyl]-2-azoniaspiro[5.5]undecane |
| SMILES | c1csc([C@@H](c2nnnn2C2CCCCC2)[NH+]2CCCC3(CCCCC3)C2)c1 |
| InChI | InChI=1S/C22H33N5S/c1-3-9-18(10-4-1)27-21(23-24-25-27)20(19-11-7-16-28-19)26-15-8-14-22(17-26)12-5-2-6-13-22/h7,11,16,18,20H,1-6,8-10,12-15,17H2/p+1/t20-/m0/s1 |
| InChIKey | PCOIWUIPQJCYFR-FQEVSTJZSA-O |
| XLogP | 3.96 |
| TPSA | 48.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.62 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |