C22H29N6OS+ — CID 7140482
4-[4-[(R)-(1-cyclohexyltetrazol-5-yl)-thiophen-2-ylmethyl]piperazin-4-ium-1-yl]phenol (PubChem CID 7140482) has the molecular formula C22H29N6OS+ and a molecular weight of 425.58 g/mol. Its IUPAC name is 4-[4-[(R)-(1-cyclohexyltetrazol-5-yl)-thiophen-2-ylmethyl]piperazin-4-ium-1-yl]phenol.
| Compound Name | 4-[4-[(R)-(1-cyclohexyltetrazol-5-yl)-thiophen-2-ylmethyl]piperazin-4-ium-1-yl]phenol |
|---|---|
| PubChem CID | 7140482 |
| Molecular Formula | C22H29N6OS+ |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 4-[4-[(R)-(1-cyclohexyltetrazol-5-yl)-thiophen-2-ylmethyl]piperazin-4-ium-1-yl]phenol |
| SMILES | Oc1ccc(N2CC[NH+]([C@@H](c3cccs3)c3nnnn3C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C22H28N6OS/c29-19-10-8-17(9-11-19)26-12-14-27(15-13-26)21(20-7-4-16-30-20)22-23-24-25-28(22)18-5-2-1-3-6-18/h4,7-11,16,18,21,29H,1-3,5-6,12-15H2/p+1/t21-/m0/s1 |
| InChIKey | LQEZXNQAJLHGCB-NRFANRHFSA-O |
| XLogP | 2.44 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |