C21H25ClN6S — CID 1431474
1-(3-chlorophenyl)-4-[(S)-(1-cyclopentyltetrazol-5-yl)-thiophen-2-ylmethyl]piperazine (PubChem CID 1431474) has the molecular formula C21H25ClN6S and a molecular weight of 428.99 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[(S)-(1-cyclopentyltetrazol-5-yl)-thiophen-2-ylmethyl]piperazine.
| Compound Name | 1-(3-chlorophenyl)-4-[(S)-(1-cyclopentyltetrazol-5-yl)-thiophen-2-ylmethyl]piperazine |
|---|---|
| PubChem CID | 1431474 |
| Molecular Formula | C21H25ClN6S |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[(S)-(1-cyclopentyltetrazol-5-yl)-thiophen-2-ylmethyl]piperazine |
| SMILES | Clc1cccc(N2CCN([C@H](c3cccs3)c3nnnn3C3CCCC3)CC2)c1 |
| InChI | InChI=1S/C21H25ClN6S/c22-16-5-3-8-18(15-16)26-10-12-27(13-11-26)20(19-9-4-14-29-19)21-23-24-25-28(21)17-6-1-2-7-17/h3-5,8-9,14-15,17,20H,1-2,6-7,10-13H2/t20-/m1/s1 |
| InChIKey | FYCOLHJKVKBCLJ-HXUWFJFHSA-N |
| XLogP | 4.41 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |