C19H28ClN6+ — CID 7140529
1-(3-chlorophenyl)-4-[(1R)-1-(1-cyclohexyltetrazol-5-yl)ethyl]piperazin-4-ium (PubChem CID 7140529) has the molecular formula C19H28ClN6+ and a molecular weight of 375.93 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[(1R)-1-(1-cyclohexyltetrazol-5-yl)ethyl]piperazin-4-ium.
| Compound Name | 1-(3-chlorophenyl)-4-[(1R)-1-(1-cyclohexyltetrazol-5-yl)ethyl]piperazin-4-ium |
|---|---|
| PubChem CID | 7140529 |
| Molecular Formula | C19H28ClN6+ |
| Molecular Weight | 375.93 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[(1R)-1-(1-cyclohexyltetrazol-5-yl)ethyl]piperazin-4-ium |
| SMILES | C[C@H](c1nnnn1C1CCCCC1)[NH+]1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H27ClN6/c1-15(19-21-22-23-26(19)17-7-3-2-4-8-17)24-10-12-25(13-11-24)18-9-5-6-16(20)14-18/h5-6,9,14-15,17H,2-4,7-8,10-13H2,1H3/p+1/t15-/m1/s1 |
| InChIKey | KVTYMLGWRTXHAY-OAHLLOKOSA-O |
| XLogP | 2.30 |
| TPSA | 51.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.93 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |