C21H32N7O2+ — CID 7383565
1-[(1R)-1-(1-cyclohexyltetrazol-5-yl)butyl]-4-(4-nitrophenyl)piperazin-1-ium (PubChem CID 7383565) has the molecular formula C21H32N7O2+ and a molecular weight of 414.53 g/mol. Its IUPAC name is 1-[(1R)-1-(1-cyclohexyltetrazol-5-yl)butyl]-4-(4-nitrophenyl)piperazin-1-ium.
| Compound Name | 1-[(1R)-1-(1-cyclohexyltetrazol-5-yl)butyl]-4-(4-nitrophenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 7383565 |
| Molecular Formula | C21H32N7O2+ |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 1-[(1R)-1-(1-cyclohexyltetrazol-5-yl)butyl]-4-(4-nitrophenyl)piperazin-1-ium |
| SMILES | CCC[C@H](c1nnnn1C1CCCCC1)[NH+]1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C21H31N7O2/c1-2-6-20(21-22-23-24-27(21)18-7-4-3-5-8-18)26-15-13-25(14-16-26)17-9-11-19(12-10-17)28(29)30/h9-12,18,20H,2-8,13-16H2,1H3/p+1/t20-/m1/s1 |
| InChIKey | FXRXZLMQLAVMRC-HXUWFJFHSA-O |
| XLogP | 2.33 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|