C27H30N8O3 — CID 3182451
3-[(1-cyclopentyltetrazol-5-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methyl]-6-methyl-1H-quinolin-2-one (PubChem CID 3182451) has the molecular formula C27H30N8O3 and a molecular weight of 514.59 g/mol. Its IUPAC name is 3-[(1-cyclopentyltetrazol-5-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methyl]-6-methyl-1H-quinolin-2-one.
| Compound Name | 3-[(1-cyclopentyltetrazol-5-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methyl]-6-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3182451 |
| Molecular Formula | C27H30N8O3 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 3-[(1-cyclopentyltetrazol-5-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methyl]-6-methyl-1H-quinolin-2-one |
| SMILES | Cc1ccc2[nH]c(=O)c(C(c3nnnn3C3CCCC3)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)cc2c1 |
| InChI | InChI=1S/C27H30N8O3/c1-18-6-11-24-19(16-18)17-23(27(36)28-24)25(26-29-30-31-34(26)21-4-2-3-5-21)33-14-12-32(13-15-33)20-7-9-22(10-8-20)35(37)38/h6-11,16-17,21,25H,2-5,12-15H2,1H3,(H,28,36) |
| InChIKey | PVEQRGONKHLVNS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 126.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|