C20H30FN6+ — CID 6985994
1-[(1S)-1-(1-cyclopentyltetrazol-5-yl)butyl]-4-(2-fluorophenyl)piperazin-1-ium (PubChem CID 6985994) has the molecular formula C20H30FN6+ and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-[(1S)-1-(1-cyclopentyltetrazol-5-yl)butyl]-4-(2-fluorophenyl)piperazin-1-ium.
| Compound Name | 1-[(1S)-1-(1-cyclopentyltetrazol-5-yl)butyl]-4-(2-fluorophenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 6985994 |
| Molecular Formula | C20H30FN6+ |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | 1-[(1S)-1-(1-cyclopentyltetrazol-5-yl)butyl]-4-(2-fluorophenyl)piperazin-1-ium |
| SMILES | CCC[C@@H](c1nnnn1C1CCCC1)[NH+]1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H29FN6/c1-2-7-19(20-22-23-24-27(20)16-8-3-4-9-16)26-14-12-25(13-15-26)18-11-6-5-10-17(18)21/h5-6,10-11,16,19H,2-4,7-9,12-15H2,1H3/p+1/t19-/m0/s1 |
| InChIKey | ZVFNTPHUFQNXLT-IBGZPJMESA-O |
| XLogP | 2.17 |
| TPSA | 51.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |