C19H27FN6 — CID 647944
1-[1-(1-cyclopentyltetrazol-5-yl)propyl]-4-(2-fluorophenyl)piperazine (PubChem CID 647944) has the molecular formula C19H27FN6 and a molecular weight of 358.47 g/mol. Its IUPAC name is 1-[1-(1-cyclopentyltetrazol-5-yl)propyl]-4-(2-fluorophenyl)piperazine.
| Compound Name | 1-[1-(1-cyclopentyltetrazol-5-yl)propyl]-4-(2-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 647944 |
| Molecular Formula | C19H27FN6 |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 1-[1-(1-cyclopentyltetrazol-5-yl)propyl]-4-(2-fluorophenyl)piperazine |
| SMILES | CCC(c1nnnn1C1CCCC1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H27FN6/c1-2-17(19-21-22-23-26(19)15-7-3-4-8-15)24-11-13-25(14-12-24)18-10-6-5-9-16(18)20/h5-6,9-10,15,17H,2-4,7-8,11-14H2,1H3 |
| InChIKey | UBPGZFYNOAIHHT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |