C22H27FN6S — CID 1438445
1-[(R)-(1-cyclohexyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-(2-fluorophenyl)piperazine (PubChem CID 1438445) has the molecular formula C22H27FN6S and a molecular weight of 426.57 g/mol. Its IUPAC name is 1-[(R)-(1-cyclohexyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-(2-fluorophenyl)piperazine.
| Compound Name | 1-[(R)-(1-cyclohexyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-(2-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 1438445 |
| Molecular Formula | C22H27FN6S |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 1-[(R)-(1-cyclohexyltetrazol-5-yl)-thiophen-2-ylmethyl]-4-(2-fluorophenyl)piperazine |
| SMILES | Fc1ccccc1N1CCN([C@@H](c2cccs2)c2nnnn2C2CCCCC2)CC1 |
| InChI | InChI=1S/C22H27FN6S/c23-18-9-4-5-10-19(18)27-12-14-28(15-13-27)21(20-11-6-16-30-20)22-24-25-26-29(22)17-7-2-1-3-8-17/h4-6,9-11,16-17,21H,1-3,7-8,12-15H2/t21-/m0/s1 |
| InChIKey | HBBHRSOBKIUCSZ-NRFANRHFSA-N |
| XLogP | 4.29 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |