C23H28FN7 — CID 1437638
1-[(S)-(1-cyclohexyltetrazol-5-yl)-pyridin-2-ylmethyl]-4-(2-fluorophenyl)piperazine (PubChem CID 1437638) has the molecular formula C23H28FN7 and a molecular weight of 421.52 g/mol. Its IUPAC name is 1-[(S)-(1-cyclohexyltetrazol-5-yl)-pyridin-2-ylmethyl]-4-(2-fluorophenyl)piperazine.
| Compound Name | 1-[(S)-(1-cyclohexyltetrazol-5-yl)-pyridin-2-ylmethyl]-4-(2-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 1437638 |
| Molecular Formula | C23H28FN7 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 1-[(S)-(1-cyclohexyltetrazol-5-yl)-pyridin-2-ylmethyl]-4-(2-fluorophenyl)piperazine |
| SMILES | Fc1ccccc1N1CCN([C@@H](c2ccccn2)c2nnnn2C2CCCCC2)CC1 |
| InChI | InChI=1S/C23H28FN7/c24-19-10-4-5-12-21(19)29-14-16-30(17-15-29)22(20-11-6-7-13-25-20)23-26-27-28-31(23)18-8-2-1-3-9-18/h4-7,10-13,18,22H,1-3,8-9,14-17H2/t22-/m0/s1 |
| InChIKey | NSCCSAZYDWRBMK-QFIPXVFZSA-N |
| XLogP | 3.62 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |