C24H31N7O — CID 1435698
1-[(R)-(1-cyclohexyltetrazol-5-yl)-pyridin-2-ylmethyl]-4-(2-methoxyphenyl)piperazine (PubChem CID 1435698) has the molecular formula C24H31N7O and a molecular weight of 433.56 g/mol. Its IUPAC name is 1-[(R)-(1-cyclohexyltetrazol-5-yl)-pyridin-2-ylmethyl]-4-(2-methoxyphenyl)piperazine.
| Compound Name | 1-[(R)-(1-cyclohexyltetrazol-5-yl)-pyridin-2-ylmethyl]-4-(2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 1435698 |
| Molecular Formula | C24H31N7O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 1-[(R)-(1-cyclohexyltetrazol-5-yl)-pyridin-2-ylmethyl]-4-(2-methoxyphenyl)piperazine |
| SMILES | COc1ccccc1N1CCN([C@H](c2ccccn2)c2nnnn2C2CCCCC2)CC1 |
| InChI | InChI=1S/C24H31N7O/c1-32-22-13-6-5-12-21(22)29-15-17-30(18-16-29)23(20-11-7-8-14-25-20)24-26-27-28-31(24)19-9-3-2-4-10-19/h5-8,11-14,19,23H,2-4,9-10,15-18H2,1H3/t23-/m1/s1 |
| InChIKey | VLVFWQWIZGWUMP-HSZRJFAPSA-N |
| XLogP | 3.49 |
| TPSA | 72.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |