C24H30N6O — CID 1443560
1-[(S)-(1-cyclopentyltetrazol-5-yl)-(2-methoxyphenyl)methyl]-4-phenylpiperazine (PubChem CID 1443560) has the molecular formula C24H30N6O and a molecular weight of 418.55 g/mol. Its IUPAC name is 1-[(S)-(1-cyclopentyltetrazol-5-yl)-(2-methoxyphenyl)methyl]-4-phenylpiperazine.
| Compound Name | 1-[(S)-(1-cyclopentyltetrazol-5-yl)-(2-methoxyphenyl)methyl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 1443560 |
| Molecular Formula | C24H30N6O |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 1-[(S)-(1-cyclopentyltetrazol-5-yl)-(2-methoxyphenyl)methyl]-4-phenylpiperazine |
| SMILES | COc1ccccc1[C@@H](c1nnnn1C1CCCC1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N6O/c1-31-22-14-8-7-13-21(22)23(24-25-26-27-30(24)20-11-5-6-12-20)29-17-15-28(16-18-29)19-9-3-2-4-10-19/h2-4,7-10,13-14,20,23H,5-6,11-12,15-18H2,1H3/t23-/m0/s1 |
| InChIKey | SWVPYRXMQSANRG-QHCPKHFHSA-N |
| XLogP | 3.71 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |