C26H34N6O2 — CID 3208651
1-[(1-cyclohexyltetrazol-5-yl)-(2,3-dimethoxyphenyl)methyl]-4-phenylpiperazine (PubChem CID 3208651) has the molecular formula C26H34N6O2 and a molecular weight of 462.60 g/mol. Its IUPAC name is 1-[(1-cyclohexyltetrazol-5-yl)-(2,3-dimethoxyphenyl)methyl]-4-phenylpiperazine.
| Compound Name | 1-[(1-cyclohexyltetrazol-5-yl)-(2,3-dimethoxyphenyl)methyl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 3208651 |
| Molecular Formula | C26H34N6O2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 1-[(1-cyclohexyltetrazol-5-yl)-(2,3-dimethoxyphenyl)methyl]-4-phenylpiperazine |
| SMILES | COc1cccc(C(c2nnnn2C2CCCCC2)N2CCN(c3ccccc3)CC2)c1OC |
| InChI | InChI=1S/C26H34N6O2/c1-33-23-15-9-14-22(25(23)34-2)24(26-27-28-29-32(26)21-12-7-4-8-13-21)31-18-16-30(17-19-31)20-10-5-3-6-11-20/h3,5-6,9-11,14-15,21,24H,4,7-8,12-13,16-19H2,1-2H3 |
| InChIKey | SKXNMMUPXCPHHN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |