C21H30N6O2 — CID 1443142
1-[(R)-(1-cyclohexyltetrazol-5-yl)-(2-methoxyphenyl)methyl]piperidine-4-carboxamide (PubChem CID 1443142) has the molecular formula C21H30N6O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 1-[(R)-(1-cyclohexyltetrazol-5-yl)-(2-methoxyphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(R)-(1-cyclohexyltetrazol-5-yl)-(2-methoxyphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 1443142 |
| Molecular Formula | C21H30N6O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 1-[(R)-(1-cyclohexyltetrazol-5-yl)-(2-methoxyphenyl)methyl]piperidine-4-carboxamide |
| SMILES | COc1ccccc1[C@H](c1nnnn1C1CCCCC1)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C21H30N6O2/c1-29-18-10-6-5-9-17(18)19(26-13-11-15(12-14-26)20(22)28)21-23-24-25-27(21)16-7-3-2-4-8-16/h5-6,9-10,15-16,19H,2-4,7-8,11-14H2,1H3,(H2,22,28)/t19-/m1/s1 |
| InChIKey | HSVAQQOQCGAFOF-LJQANCHMSA-N |
| XLogP | 2.47 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |