C19H27N5O — CID 7436527
1-cyclohexyl-5-[(R)-(2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole (PubChem CID 7436527) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is 1-cyclohexyl-5-[(R)-(2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole.
| Compound Name | 1-cyclohexyl-5-[(R)-(2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole |
|---|---|
| PubChem CID | 7436527 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 1-cyclohexyl-5-[(R)-(2-methoxyphenyl)-pyrrolidin-1-ylmethyl]tetrazole |
| SMILES | COc1ccccc1[C@H](c1nnnn1C1CCCCC1)N1CCCC1 |
| InChI | InChI=1S/C19H27N5O/c1-25-17-12-6-5-11-16(17)18(23-13-7-8-14-23)19-20-21-22-24(19)15-9-3-2-4-10-15/h5-6,11-12,15,18H,2-4,7-10,13-14H2,1H3/t18-/m1/s1 |
| InChIKey | WPGBDVAPOKIDRU-GOSISDBHSA-N |
| XLogP | 3.37 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |