C17H30N6O — CID 857870
1-[(1S)-1-(1-cyclohexyltetrazol-5-yl)-2-methylpropyl]piperidine-4-carboxamide (PubChem CID 857870) has the molecular formula C17H30N6O and a molecular weight of 334.47 g/mol. Its IUPAC name is 1-[(1S)-1-(1-cyclohexyltetrazol-5-yl)-2-methylpropyl]piperidine-4-carboxamide.
| Compound Name | 1-[(1S)-1-(1-cyclohexyltetrazol-5-yl)-2-methylpropyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 857870 |
| Molecular Formula | C17H30N6O |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 1-[(1S)-1-(1-cyclohexyltetrazol-5-yl)-2-methylpropyl]piperidine-4-carboxamide |
| SMILES | CC(C)[C@@H](c1nnnn1C1CCCCC1)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C17H30N6O/c1-12(2)15(22-10-8-13(9-11-22)16(18)24)17-19-20-21-23(17)14-6-4-3-5-7-14/h12-15H,3-11H2,1-2H3,(H2,18,24)/t15-/m0/s1 |
| InChIKey | HGZVXHHCZFPCQI-HNNXBMFYSA-N |
| XLogP | 2.07 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |