C17H31N6O+ — CID 7383600
1-[(1R)-1-(1-cyclohexyltetrazol-5-yl)-2-methylpropyl]piperidin-1-ium-4-carboxamide (PubChem CID 7383600) has the molecular formula C17H31N6O+ and a molecular weight of 335.48 g/mol. Its IUPAC name is 1-[(1R)-1-(1-cyclohexyltetrazol-5-yl)-2-methylpropyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(1R)-1-(1-cyclohexyltetrazol-5-yl)-2-methylpropyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7383600 |
| Molecular Formula | C17H31N6O+ |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 1-[(1R)-1-(1-cyclohexyltetrazol-5-yl)-2-methylpropyl]piperidin-1-ium-4-carboxamide |
| SMILES | CC(C)[C@H](c1nnnn1C1CCCCC1)[NH+]1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C17H30N6O/c1-12(2)15(22-10-8-13(9-11-22)16(18)24)17-19-20-21-23(17)14-6-4-3-5-7-14/h12-15H,3-11H2,1-2H3,(H2,18,24)/p+1/t15-/m1/s1 |
| InChIKey | HGZVXHHCZFPCQI-OAHLLOKOSA-O |
| XLogP | 0.66 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |