C16H29N6O+ — CID 7383765
1-[(1S)-1-(1-cyclopentyltetrazol-5-yl)-2-methylpropyl]piperidin-1-ium-4-carboxamide (PubChem CID 7383765) has the molecular formula C16H29N6O+ and a molecular weight of 321.45 g/mol. Its IUPAC name is 1-[(1S)-1-(1-cyclopentyltetrazol-5-yl)-2-methylpropyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(1S)-1-(1-cyclopentyltetrazol-5-yl)-2-methylpropyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7383765 |
| Molecular Formula | C16H29N6O+ |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | 1-[(1S)-1-(1-cyclopentyltetrazol-5-yl)-2-methylpropyl]piperidin-1-ium-4-carboxamide |
| SMILES | CC(C)[C@@H](c1nnnn1C1CCCC1)[NH+]1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C16H28N6O/c1-11(2)14(21-9-7-12(8-10-21)15(17)23)16-18-19-20-22(16)13-5-3-4-6-13/h11-14H,3-10H2,1-2H3,(H2,17,23)/p+1/t14-/m0/s1 |
| InChIKey | BRBIMHZJACCYKO-AWEZNQCLSA-O |
| XLogP | 0.27 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |